Cargando…

Strecker degradation of amino acids promoted by a camphor-derived sulfonamide

A camphor-derived sulfonimine with a conjugated carbonyl group, oxoimine 1 (O(2)SNC(10)H(13)O), reacts with amino acids (glycine, L-alanine, L-phenylalanine, L-leucine) to form a compound O(2)SNC(10)H(13)NC(10)H(14)NSO(2) (2) which was characterized by spectroscopic means (MS and NMR) and supported...

Descripción completa

Detalles Bibliográficos
Autores principales: Carvalho, M Fernanda N N, Ferreira, M João, Knittel, Ana S O, Oliveira, Maria da Conceição, Costa Pessoa, João, Herrmann, Rudolf, Wagner, Gabriele
Formato: Online Artículo Texto
Lenguaje:English
Publicado: Beilstein-Institut 2016
Materias:
Acceso en línea:https://www.ncbi.nlm.nih.gov/pmc/articles/PMC4902088/
https://www.ncbi.nlm.nih.gov/pubmed/27340465
http://dx.doi.org/10.3762/bjoc.12.73
Descripción
Sumario:A camphor-derived sulfonimine with a conjugated carbonyl group, oxoimine 1 (O(2)SNC(10)H(13)O), reacts with amino acids (glycine, L-alanine, L-phenylalanine, L-leucine) to form a compound O(2)SNC(10)H(13)NC(10)H(14)NSO(2) (2) which was characterized by spectroscopic means (MS and NMR) and supported by DFT calculations. The product, a single diastereoisomer, contains two oxoimine units connected by a –N= bridge, and thus has a structural analogy to the colored product Ruhemann´s purple obtained by the ninhydrin reaction with amino acids. A plausible reaction mechanism that involves zwitterions, a Strecker degradation of an intermediate imine and water-catalyzed tautomerizations was developed by means of DFT calculations on potential transition states.